C9H12N4OS2 — CID 80613805
[5-(2-thiophen-2-ylethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80613805) has the molecular formula C9H12N4OS2 and a molecular weight of 256.36 g/mol. Its IUPAC name is [5-(2-thiophen-2-ylethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-(2-thiophen-2-ylethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80613805 |
| Molecular Formula | C9H12N4OS2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [5-(2-thiophen-2-ylethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(COCCc2cccs2)s1 |
| InChI | InChI=1S/C9H12N4OS2/c10-11-9-13-12-8(16-9)6-14-4-3-7-2-1-5-15-7/h1-2,5H,3-4,6,10H2,(H,11,13) |
| InChIKey | DEGJZOZCODHFEX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|