C11H12N4O3S — CID 80614802
[5-(1,3-benzodioxol-5-ylmethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80614802) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-ylmethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-(1,3-benzodioxol-5-ylmethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80614802 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [5-(1,3-benzodioxol-5-ylmethoxymethyl)-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(COCc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C11H12N4O3S/c12-13-11-15-14-10(19-11)5-16-4-7-1-2-8-9(3-7)18-6-17-8/h1-3H,4-6,12H2,(H,13,15) |
| InChIKey | ODQZUYBQTUUDPQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|