C11H11N3O3S — CID 62194277
4-(1,3-benzodioxol-5-ylmethoxymethyl)thiadiazol-5-amine (PubChem CID 62194277) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethoxymethyl)thiadiazol-5-amine.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethoxymethyl)thiadiazol-5-amine |
|---|---|
| PubChem CID | 62194277 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethoxymethyl)thiadiazol-5-amine |
| SMILES | Nc1snnc1COCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11N3O3S/c12-11-8(13-14-18-11)5-15-4-7-1-2-9-10(3-7)17-6-16-9/h1-3H,4-6,12H2 |
| InChIKey | POATUSCHENOQRK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |