C10H11BrN4OS — CID 82831907
[5-[(4-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 82831907) has the molecular formula C10H11BrN4OS and a molecular weight of 315.20 g/mol. Its IUPAC name is [5-[(4-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 82831907 |
| Molecular Formula | C10H11BrN4OS |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | [5-[(4-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(COCc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C10H11BrN4OS/c11-8-3-1-7(2-4-8)5-16-6-9-14-15-10(13-12)17-9/h1-4H,5-6,12H2,(H,13,15) |
| InChIKey | NKPNBHQLNNSMLY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|