C12H15N3OS — CID 80608751
N-ethyl-5-(phenylmethoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80608751) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-ethyl-5-(phenylmethoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-ethyl-5-(phenylmethoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80608751 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-ethyl-5-(phenylmethoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(COCc2ccccc2)s1 |
| InChI | InChI=1S/C12H15N3OS/c1-2-13-12-15-14-11(17-12)9-16-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,15) |
| InChIKey | DGWDULDUQDHKOE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |