C13H11N3S2 — CID 79260065
2-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-4-amine (PubChem CID 79260065) has the molecular formula C13H11N3S2 and a molecular weight of 273.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-4-amine.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 79260065 |
| Molecular Formula | C13H11N3S2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-4-amine |
| SMILES | Nc1ccnc(CSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C13H11N3S2/c14-9-5-6-15-10(7-9)8-17-13-16-11-3-1-2-4-12(11)18-13/h1-7H,8H2,(H2,14,15) |
| InChIKey | NYPBPVOYUGBOSP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |