C11H10BrF3N2O3 — CID 79261272
4-bromo-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzoic acid (PubChem CID 79261272) has the molecular formula C11H10BrF3N2O3 and a molecular weight of 355.11 g/mol. Its IUPAC name is 4-bromo-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzoic acid.
| Compound Name | 4-bromo-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 79261272 |
| Molecular Formula | C11H10BrF3N2O3 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 4-bromo-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzoic acid |
| SMILES | O=C(CNCC(F)(F)F)Nc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C11H10BrF3N2O3/c12-6-1-2-7(10(19)20)8(3-6)17-9(18)4-16-5-11(13,14)15/h1-3,16H,4-5H2,(H,17,18)(H,19,20) |
| InChIKey | NSBARUUKGISSPZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |