About 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid
2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid (PubChem CID 79261617) has the molecular formula C9H15F3N2O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid |
| PubChem CID | 79261617 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O3/c1-3-6(8(16)17)14(2)7(15)4-13-5-9(10,11)12/h6,13H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | HLXRQHRSUFQKSI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid?
The IUPAC name of 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid (CID 79261617) is 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid.
What is the SMILES notation for 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid?
The canonical SMILES for 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid is CCC(C(=O)O)N(C)C(=O)CNCC(F)(F)F.
What is the InChIKey of 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid?
The InChIKey is HLXRQHRSUFQKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c1-3-6(8(16)17)14(2)7(15)4-13-5-9(10,11)12/h6,13H,3-5H2,1-2H3,(H,16,17).
What are the key properties of 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid?
2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid has a molecular weight of 256.22 g/mol, XLogP of 0.46, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[2-(2,2,2-trifluoroethylamino)acetyl]amino]butanoic acid is sourced from PubChem (CID 79261617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).