About N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine
N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine (PubChem CID 79261906) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine.
Molecular Properties
| Compound Name | N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine |
| PubChem CID | 79261906 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine |
| SMILES | CCCNc1ccnc(COc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C18H24N2O/c1-5-7-19-16-6-8-20-17(11-16)12-21-18-14(3)9-13(2)10-15(18)4/h6,8-11H,5,7,12H2,1-4H3,(H,19,20) |
| InChIKey | AEMICWXVXYEBIE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine?
The IUPAC name of N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine (CID 79261906) is N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine.
What is the SMILES notation for N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine?
The canonical SMILES for N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine is CCCNc1ccnc(COc2c(C)cc(C)cc2C)c1.
What is the InChIKey of N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine?
The InChIKey is AEMICWXVXYEBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O/c1-5-7-19-16-6-8-20-17(11-16)12-21-18-14(3)9-13(2)10-15(18)4/h6,8-11H,5,7,12H2,1-4H3,(H,19,20).
What are the key properties of N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine?
N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine has a molecular weight of 284.40 g/mol, XLogP of 4.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-2-[(2,4,6-trimethylphenoxy)methyl]pyridin-4-amine is sourced from PubChem (CID 79261906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).