About [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine
[2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine (PubChem CID 79262177) has the molecular formula C14H16N4O3
and a molecular weight of 288.31 g/mol. Its IUPAC name is [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine |
| PubChem CID | 79262177 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine |
| SMILES | Cc1cc(C)c(OCc2cc(NN)ccn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N4O3/c1-9-5-10(2)14(13(6-9)18(19)20)21-8-12-7-11(17-15)3-4-16-12/h3-7H,8,15H2,1-2H3,(H,16,17) |
| InChIKey | VQQXBFDSFKHMIR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine?
The IUPAC name of [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine (CID 79262177) is [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine.
What is the SMILES notation for [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine?
The canonical SMILES for [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine is Cc1cc(C)c(OCc2cc(NN)ccn2)c([N+](=O)[O-])c1.
What is the InChIKey of [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine?
The InChIKey is VQQXBFDSFKHMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O3/c1-9-5-10(2)14(13(6-9)18(19)20)21-8-12-7-11(17-15)3-4-16-12/h3-7H,8,15H2,1-2H3,(H,16,17).
What are the key properties of [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine?
[2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine has a molecular weight of 288.31 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,4-dimethyl-6-nitrophenoxy)methyl]-4-pyridinyl]hydrazine is sourced from PubChem (CID 79262177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).