C11H14N2O3S — CID 79264506
2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-prop-2-enylamino]acetic acid (PubChem CID 79264506) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79264506 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C11H14N2O3S/c1-3-4-13(6-11(15)16)10(14)5-9-7-17-8(2)12-9/h3,7H,1,4-6H2,2H3,(H,15,16) |
| InChIKey | DXGBPUWDDDDOMC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|