C9H10F3NO3 — CID 79266796
2-[furan-3-ylmethyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79266796) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is 2-[furan-3-ylmethyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[furan-3-ylmethyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79266796 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-[furan-3-ylmethyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccoc1)CC(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c10-9(11,12)6-13(4-8(14)15)3-7-1-2-16-5-7/h1-2,5H,3-4,6H2,(H,14,15) |
| InChIKey | CAYFEMVVUALLNG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |