C14H17ClN2O2S — CID 79267384
3-amino-5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 79267384) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79267384 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-amino-5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)[C@@H](CO)NC(=O)c1sc2ccc(Cl)cc2c1N |
| InChI | InChI=1S/C14H17ClN2O2S/c1-7(2)10(6-18)17-14(19)13-12(16)9-5-8(15)3-4-11(9)20-13/h3-5,7,10,18H,6,16H2,1-2H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | ODUOWHHPYXQVEQ-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |