C10H18N2O3 — CID 79270267
N-(1,1-dimethoxypropan-2-yl)-2-(prop-2-ynylamino)acetamide (PubChem CID 79270267) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79270267 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)NC(C)C(OC)OC |
| InChI | InChI=1S/C10H18N2O3/c1-5-6-11-7-9(13)12-8(2)10(14-3)15-4/h1,8,10-11H,6-7H2,2-4H3,(H,12,13) |
| InChIKey | WASGLZSXQIAHTQ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|