C12H21N3O2 — CID 79287630
N,4-dimethyl-2-[[2-(prop-2-ynylamino)acetyl]amino]pentanamide (PubChem CID 79287630) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N,4-dimethyl-2-[[2-(prop-2-ynylamino)acetyl]amino]pentanamide.
| Compound Name | N,4-dimethyl-2-[[2-(prop-2-ynylamino)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 79287630 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N,4-dimethyl-2-[[2-(prop-2-ynylamino)acetyl]amino]pentanamide |
| SMILES | C#CCNCC(=O)NC(CC(C)C)C(=O)NC |
| InChI | InChI=1S/C12H21N3O2/c1-5-6-14-8-11(16)15-10(7-9(2)3)12(17)13-4/h1,9-10,14H,6-8H2,2-4H3,(H,13,17)(H,15,16) |
| InChIKey | YZDLYDKAJGMUII-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|