C11H10N2O2S — CID 792704
4-(3-ethylpyridin-1-ium-1-yl)-5-formyl-1,3-thiazol-2-olate (PubChem CID 792704) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-(3-ethylpyridin-1-ium-1-yl)-5-formyl-1,3-thiazol-2-olate.
| Compound Name | 4-(3-ethylpyridin-1-ium-1-yl)-5-formyl-1,3-thiazol-2-olate |
|---|---|
| PubChem CID | 792704 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-(3-ethylpyridin-1-ium-1-yl)-5-formyl-1,3-thiazol-2-olate |
| SMILES | CCc1ccc[n+](-c2nc([O-])sc2C=O)c1 |
| InChI | InChI=1S/C11H10N2O2S/c1-2-8-4-3-5-13(6-8)10-9(7-14)16-11(15)12-10/h3-7H,2H2,1H3 |
| InChIKey | DTRQNYVZJYZNQW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|