C15H24N2O4 — CID 79270541
N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(2-methoxyethylamino)acetamide (PubChem CID 79270541) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 79270541 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)NC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-11(17-15(18)10-16-7-8-19-2)12-5-6-13(20-3)14(9-12)21-4/h5-6,9,11,16H,7-8,10H2,1-4H3,(H,17,18) |
| InChIKey | FTZYAEHTARQURP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|