C14H10IN3O2S — CID 79271520
2-[1-(4-iodophenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetic acid (PubChem CID 79271520) has the molecular formula C14H10IN3O2S and a molecular weight of 411.22 g/mol. Its IUPAC name is 2-[1-(4-iodophenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(4-iodophenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 79271520 |
| Molecular Formula | C14H10IN3O2S |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 2-[1-(4-iodophenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2cnccc2n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C14H10IN3O2S/c15-9-1-3-10(4-2-9)18-12-5-6-16-7-11(12)17-14(18)21-8-13(19)20/h1-7H,8H2,(H,19,20) |
| InChIKey | FHTICAXSZZEGCD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|