C15H17IN2O2S — CID 81344246
2-[5-tert-butyl-1-(4-iodophenyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81344246) has the molecular formula C15H17IN2O2S and a molecular weight of 416.28 g/mol. Its IUPAC name is 2-[5-tert-butyl-1-(4-iodophenyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-tert-butyl-1-(4-iodophenyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81344246 |
| Molecular Formula | C15H17IN2O2S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 2-[5-tert-butyl-1-(4-iodophenyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CC(C)(C)c1cnc(SCC(=O)O)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C15H17IN2O2S/c1-15(2,3)12-8-17-14(21-9-13(19)20)18(12)11-6-4-10(16)5-7-11/h4-8H,9H2,1-3H3,(H,19,20) |
| InChIKey | IVWUEOIHBSHZDB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|