C14H27N3O4 — CID 79271648
2-[2-methoxyethyl-[methyl-[(1-methylpiperidin-4-yl)methyl]carbamoyl]amino]acetic acid (PubChem CID 79271648) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[methyl-[(1-methylpiperidin-4-yl)methyl]carbamoyl]amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-[methyl-[(1-methylpiperidin-4-yl)methyl]carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 79271648 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[2-methoxyethyl-[methyl-[(1-methylpiperidin-4-yl)methyl]carbamoyl]amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)N(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C14H27N3O4/c1-15-6-4-12(5-7-15)10-16(2)14(20)17(8-9-21-3)11-13(18)19/h12H,4-11H2,1-3H3,(H,18,19) |
| InChIKey | USDCPKSWCPEUHE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |