C12H19F3N2O4 — CID 79272734
2-[2-methoxyethyl-[3-(trifluoromethyl)piperidine-1-carbonyl]amino]acetic acid (PubChem CID 79272734) has the molecular formula C12H19F3N2O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[3-(trifluoromethyl)piperidine-1-carbonyl]amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-[3-(trifluoromethyl)piperidine-1-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 79272734 |
| Molecular Formula | C12H19F3N2O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[2-methoxyethyl-[3-(trifluoromethyl)piperidine-1-carbonyl]amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N2O4/c1-21-6-5-17(8-10(18)19)11(20)16-4-2-3-9(7-16)12(13,14)15/h9H,2-8H2,1H3,(H,18,19) |
| InChIKey | JKCVYZCLCFHQCC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |