C13H14N4O2S2 — CID 79273432
1,3-dimethyl-6-(4-methylsulfonylphenyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79273432) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1,3-dimethyl-6-(4-methylsulfonylphenyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 1,3-dimethyl-6-(4-methylsulfonylphenyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79273432 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1,3-dimethyl-6-(4-methylsulfonylphenyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H14N4O2S2/c1-8-11-12(16(2)15-8)17(13(20)14-11)9-4-6-10(7-5-9)21(3,18)19/h4-7H,1-3H3,(H,14,20) |
| InChIKey | LCNRVLHCHUULCK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|