C13H15N3OS — CID 79276959
N-[[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine (PubChem CID 79276959) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79276959 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1nc(CSc2ccccc2)no1 |
| InChI | InChI=1S/C13H15N3OS/c1-2-8-14-9-13-15-12(16-17-13)10-18-11-6-4-3-5-7-11/h2-7,14H,1,8-10H2 |
| InChIKey | RANFFFCJAQQYSZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|