C12H12ClFN2O3 — CID 79277035
2-[(5-chloro-2-fluorophenyl)carbamoyl-prop-2-enylamino]acetic acid (PubChem CID 79277035) has the molecular formula C12H12ClFN2O3 and a molecular weight of 286.69 g/mol. Its IUPAC name is 2-[(5-chloro-2-fluorophenyl)carbamoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(5-chloro-2-fluorophenyl)carbamoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79277035 |
| Molecular Formula | C12H12ClFN2O3 |
| Molecular Weight | 286.69 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[(5-chloro-2-fluorophenyl)carbamoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H12ClFN2O3/c1-2-5-16(7-11(17)18)12(19)15-10-6-8(13)3-4-9(10)14/h2-4,6H,1,5,7H2,(H,15,19)(H,17,18) |
| InChIKey | HQAHBJNXRILORW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|