C13H14F2N2O3 — CID 82819343
2-[(2,6-difluoro-3-methylphenyl)carbamoyl-prop-2-enylamino]acetic acid (PubChem CID 82819343) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-[(2,6-difluoro-3-methylphenyl)carbamoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(2,6-difluoro-3-methylphenyl)carbamoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 82819343 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[(2,6-difluoro-3-methylphenyl)carbamoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)Nc1c(F)ccc(C)c1F |
| InChI | InChI=1S/C13H14F2N2O3/c1-3-6-17(7-10(18)19)13(20)16-12-9(14)5-4-8(2)11(12)15/h3-5H,1,6-7H2,2H3,(H,16,20)(H,18,19) |
| InChIKey | OPONXEJDERCDGG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|