C10H17N3O — CID 79277376
N-[(3-butan-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine (PubChem CID 79277376) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-[(3-butan-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(3-butan-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79277376 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-[(3-butan-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1nc(C(C)CC)no1 |
| InChI | InChI=1S/C10H17N3O/c1-4-6-11-7-9-12-10(13-14-9)8(3)5-2/h4,8,11H,1,5-7H2,2-3H3 |
| InChIKey | JZTAZYCNVDVEJY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|