C15H20ClN3O2 — CID 79278721
methyl 2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanoate (PubChem CID 79278721) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is methyl 2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanoate.
| Compound Name | methyl 2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 79278721 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl 2-[2-(1-chloroethyl)-6-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanoate |
| SMILES | COC(=O)C(C(C)C)n1c(C(C)Cl)nc2cc(C)cnc21 |
| InChI | InChI=1S/C15H20ClN3O2/c1-8(2)12(15(20)21-5)19-13(10(4)16)18-11-6-9(3)7-17-14(11)19/h6-8,10,12H,1-5H3 |
| InChIKey | CMYQVYNBHVBBNV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|