C9H14N2O5 — CID 79279874
2-[carboxymethyl-[2-(prop-2-enylamino)acetyl]amino]acetic acid (PubChem CID 79279874) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(prop-2-enylamino)acetyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(prop-2-enylamino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 79279874 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-[carboxymethyl-[2-(prop-2-enylamino)acetyl]amino]acetic acid |
| SMILES | C=CCNCC(=O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C9H14N2O5/c1-2-3-10-4-7(12)11(5-8(13)14)6-9(15)16/h2,10H,1,3-6H2,(H,13,14)(H,15,16) |
| InChIKey | DDLPVKINHWLCCF-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|