About 2-(prop-2-enylamino)acetic acid;pyrimidine
2-(prop-2-enylamino)acetic acid;pyrimidine (PubChem CID 67804683) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(prop-2-enylamino)acetic acid;pyrimidine.
Molecular Properties
| Compound Name | 2-(prop-2-enylamino)acetic acid;pyrimidine |
| PubChem CID | 67804683 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(prop-2-enylamino)acetic acid;pyrimidine |
| SMILES | C=CCNCC(=O)O.c1cncnc1 |
| InChI | InChI=1S/C5H9NO2.C4H4N2/c1-2-3-6-4-5(7)8;1-2-5-4-6-3-1/h2,6H,1,3-4H2,(H,7,8);1-4H |
| InChIKey | LCDMOSKKCVCMBK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(prop-2-enylamino)acetic acid;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(prop-2-enylamino)acetic acid;pyrimidine?
The IUPAC name of 2-(prop-2-enylamino)acetic acid;pyrimidine (CID 67804683) is 2-(prop-2-enylamino)acetic acid;pyrimidine.
What is the SMILES notation for 2-(prop-2-enylamino)acetic acid;pyrimidine?
The canonical SMILES for 2-(prop-2-enylamino)acetic acid;pyrimidine is C=CCNCC(=O)O.c1cncnc1.
What is the InChIKey of 2-(prop-2-enylamino)acetic acid;pyrimidine?
The InChIKey is LCDMOSKKCVCMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C4H4N2/c1-2-3-6-4-5(7)8;1-2-5-4-6-3-1/h2,6H,1,3-4H2,(H,7,8);1-4H.
What are the key properties of 2-(prop-2-enylamino)acetic acid;pyrimidine?
2-(prop-2-enylamino)acetic acid;pyrimidine has a molecular weight of 195.22 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(prop-2-enylamino)acetic acid;pyrimidine is sourced from PubChem (CID 67804683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).