C12H18N2O3S — CID 79279881
2-cyclopropyl-3-[2-(prop-2-enylamino)acetyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 79279881) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-cyclopropyl-3-[2-(prop-2-enylamino)acetyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-cyclopropyl-3-[2-(prop-2-enylamino)acetyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 79279881 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-cyclopropyl-3-[2-(prop-2-enylamino)acetyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C=CCNCC(=O)N1C(C(=O)O)CSC1C1CC1 |
| InChI | InChI=1S/C12H18N2O3S/c1-2-5-13-6-10(15)14-9(12(16)17)7-18-11(14)8-3-4-8/h2,8-9,11,13H,1,3-7H2,(H,16,17) |
| InChIKey | XRQGCGYNPOZHFW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|