C8H17N3O3S — CID 79280560
2-(prop-2-enylamino)-N-(3-sulfamoylpropyl)acetamide (PubChem CID 79280560) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-N-(3-sulfamoylpropyl)acetamide.
| Compound Name | 2-(prop-2-enylamino)-N-(3-sulfamoylpropyl)acetamide |
|---|---|
| PubChem CID | 79280560 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(prop-2-enylamino)-N-(3-sulfamoylpropyl)acetamide |
| SMILES | C=CCNCC(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C8H17N3O3S/c1-2-4-10-7-8(12)11-5-3-6-15(9,13)14/h2,10H,1,3-7H2,(H,11,12)(H2,9,13,14) |
| InChIKey | ORHNMIQOORJUJH-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|