C6H14N4O4S — CID 76927870
3-amino-3-hydroxyimino-N-(3-sulfamoylpropyl)propanamide (PubChem CID 76927870) has the molecular formula C6H14N4O4S and a molecular weight of 238.27 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-N-(3-sulfamoylpropyl)propanamide.
| Compound Name | 3-amino-3-hydroxyimino-N-(3-sulfamoylpropyl)propanamide |
|---|---|
| PubChem CID | 76927870 |
| Molecular Formula | C6H14N4O4S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-amino-3-hydroxyimino-N-(3-sulfamoylpropyl)propanamide |
| SMILES | NC(CC(=O)NCCCS(N)(=O)=O)=NO |
| InChI | InChI=1S/C6H14N4O4S/c7-5(10-12)4-6(11)9-2-1-3-15(8,13)14/h12H,1-4H2,(H2,7,10)(H,9,11)(H2,8,13,14) |
| InChIKey | KPSXDPRBTGGTGA-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|