C14H23N5OS — CID 79283129
1-ethyl-3-methyl-6-(1-morpholin-4-ylpropan-2-yl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79283129) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-ethyl-3-methyl-6-(1-morpholin-4-ylpropan-2-yl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 1-ethyl-3-methyl-6-(1-morpholin-4-ylpropan-2-yl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79283129 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-ethyl-3-methyl-6-(1-morpholin-4-ylpropan-2-yl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCn1nc(C)c2[nH]c(=S)n(C(C)CN3CCOCC3)c21 |
| InChI | InChI=1S/C14H23N5OS/c1-4-18-13-12(11(3)16-18)15-14(21)19(13)10(2)9-17-5-7-20-8-6-17/h10H,4-9H2,1-3H3,(H,15,21) |
| InChIKey | IOKXRFPCDRVYNH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|