C14H19N5S2 — CID 79283363
6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1-ethyl-3-methyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79283363) has the molecular formula C14H19N5S2 and a molecular weight of 321.48 g/mol. Its IUPAC name is 6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1-ethyl-3-methyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1-ethyl-3-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79283363 |
| Molecular Formula | C14H19N5S2 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1-ethyl-3-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCn1nc(C)c2[nH]c(=S)n(C(C)c3sc(C)nc3C)c21 |
| InChI | InChI=1S/C14H19N5S2/c1-6-18-13-11(7(2)17-18)16-14(20)19(13)9(4)12-8(3)15-10(5)21-12/h9H,6H2,1-5H3,(H,16,20) |
| InChIKey | SQPDMJLMWIBEDM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|