C14H16N4S2 — CID 81138510
3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 81138510) has the molecular formula C14H16N4S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 81138510 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(C(C)c3sc(C)nc3C)c2n1 |
| InChI | InChI=1S/C14H16N4S2/c1-7-5-6-11-13(15-7)18(14(19)17-11)9(3)12-8(2)16-10(4)20-12/h5-6,9H,1-4H3,(H,17,19) |
| InChIKey | QNGINJLFJHSJTM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|