C13H17N5S2 — CID 79297819
6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79297819) has the molecular formula C13H17N5S2 and a molecular weight of 307.45 g/mol. Its IUPAC name is 6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79297819 |
| Molecular Formula | C13H17N5S2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 6-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nc(C)c(C(C)n2c(=S)[nH]c3c(C)nn(C)c32)s1 |
| InChI | InChI=1S/C13H17N5S2/c1-6-10-12(17(5)16-6)18(13(19)15-10)8(3)11-7(2)14-9(4)20-11/h8H,1-5H3,(H,15,19) |
| InChIKey | VIEOPRHEXLZOFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|