C13H16N4S2 — CID 79304844
1-ethyl-3-methyl-6-(1-thiophen-2-ylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79304844) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-ethyl-3-methyl-6-(1-thiophen-2-ylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 1-ethyl-3-methyl-6-(1-thiophen-2-ylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79304844 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-ethyl-3-methyl-6-(1-thiophen-2-ylethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCn1nc(C)c2[nH]c(=S)n(C(C)c3cccs3)c21 |
| InChI | InChI=1S/C13H16N4S2/c1-4-16-12-11(8(2)15-16)14-13(18)17(12)9(3)10-6-5-7-19-10/h5-7,9H,4H2,1-3H3,(H,14,18) |
| InChIKey | SEYQMRJOMXUPJJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|