C15H24N4S — CID 81139065
3-[1-(dimethylamino)-4-methylpentan-2-yl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 81139065) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-[1-(dimethylamino)-4-methylpentan-2-yl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-[1-(dimethylamino)-4-methylpentan-2-yl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 81139065 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-[1-(dimethylamino)-4-methylpentan-2-yl]-5-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(C(CC(C)C)CN(C)C)c2n1 |
| InChI | InChI=1S/C15H24N4S/c1-10(2)8-12(9-18(4)5)19-14-13(17-15(19)20)7-6-11(3)16-14/h6-7,10,12H,8-9H2,1-5H3,(H,17,20) |
| InChIKey | WSQNHAYNNXIIDB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|