C14H16BrClN4S — CID 79283577
6-[(5-bromothiophen-2-yl)methyl]-5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazole (PubChem CID 79283577) has the molecular formula C14H16BrClN4S and a molecular weight of 387.73 g/mol. Its IUPAC name is 6-[(5-bromothiophen-2-yl)methyl]-5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazole.
| Compound Name | 6-[(5-bromothiophen-2-yl)methyl]-5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79283577 |
| Molecular Formula | C14H16BrClN4S |
| Molecular Weight | 387.73 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 6-[(5-bromothiophen-2-yl)methyl]-5-(chloromethyl)-1-methyl-3-propylimidazo[4,5-d]pyrazole |
| SMILES | CCCc1nn(C)c2c1nc(CCl)n2Cc1ccc(Br)s1 |
| InChI | InChI=1S/C14H16BrClN4S/c1-3-4-10-13-14(19(2)18-10)20(12(7-16)17-13)8-9-5-6-11(15)21-9/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | DTZVFPXEHYGDNW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|