C14H13NO2S — CID 79284223
2-[1-benzothiophen-3-ylmethyl(prop-2-ynyl)amino]acetic acid (PubChem CID 79284223) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-[1-benzothiophen-3-ylmethyl(prop-2-ynyl)amino]acetic acid.
| Compound Name | 2-[1-benzothiophen-3-ylmethyl(prop-2-ynyl)amino]acetic acid |
|---|---|
| PubChem CID | 79284223 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[1-benzothiophen-3-ylmethyl(prop-2-ynyl)amino]acetic acid |
| SMILES | C#CCN(CC(=O)O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H13NO2S/c1-2-7-15(9-14(16)17)8-11-10-18-13-6-4-3-5-12(11)13/h1,3-6,10H,7-9H2,(H,16,17) |
| InChIKey | FLHMRRPHKUKJDP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|