C14H17ClN6 — CID 79285997
5-(chloromethyl)-1-ethyl-3-methyl-6-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-d]pyrazole (PubChem CID 79285997) has the molecular formula C14H17ClN6 and a molecular weight of 304.79 g/mol. Its IUPAC name is 5-(chloromethyl)-1-ethyl-3-methyl-6-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1-ethyl-3-methyl-6-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79285997 |
| Molecular Formula | C14H17ClN6 |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 5-(chloromethyl)-1-ethyl-3-methyl-6-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-d]pyrazole |
| SMILES | CCn1nc(C)c2nc(CCl)n(Cc3cnc(C)cn3)c21 |
| InChI | InChI=1S/C14H17ClN6/c1-4-21-14-13(10(3)19-21)18-12(5-15)20(14)8-11-7-16-9(2)6-17-11/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | QTIODOYTVJKKQC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|