C16H20N2O4 — CID 792862
diethyl (1R,2S)-1,2-dicyanospiro[2.5]octane-1,2-dicarboxylate (PubChem CID 792862) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is diethyl (1R,2S)-1,2-dicyanospiro[2.5]octane-1,2-dicarboxylate.
| Compound Name | diethyl (1R,2S)-1,2-dicyanospiro[2.5]octane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 792862 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | diethyl (1R,2S)-1,2-dicyanospiro[2.5]octane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)C2(CCCCC2)[C@@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C16H20N2O4/c1-3-21-12(19)15(10-17)14(8-6-5-7-9-14)16(15,11-18)13(20)22-4-2/h3-9H2,1-2H3/t15-,16+ |
| InChIKey | AHUDKFQDRMNGNC-IYBDPMFKSA-N |
| XLogP | 2.10 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |