C9H14N4O — CID 79286309
N-(1-methylpyrazol-4-yl)-2-(prop-2-enylamino)acetamide (PubChem CID 79286309) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-(1-methylpyrazol-4-yl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(1-methylpyrazol-4-yl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79286309 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-(1-methylpyrazol-4-yl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1cnn(C)c1 |
| InChI | InChI=1S/C9H14N4O/c1-3-4-10-6-9(14)12-8-5-11-13(2)7-8/h3,5,7,10H,1,4,6H2,2H3,(H,12,14) |
| InChIKey | DMNFAKRDGXSSAC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|