C21H29N2O3+ — CID 7928757
[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-(3-ethoxypropyl)azanium (PubChem CID 7928757) has the molecular formula C21H29N2O3+ and a molecular weight of 357.47 g/mol. Its IUPAC name is [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-(3-ethoxypropyl)azanium.
| Compound Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-(3-ethoxypropyl)azanium |
|---|---|
| PubChem CID | 7928757 |
| Molecular Formula | C21H29N2O3+ |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-(3-ethoxypropyl)azanium |
| SMILES | CCOCCC[NH2+][C@H](C(=O)Nc1ccccc1OCC)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O3/c1-3-25-16-10-15-22-20(17-11-6-5-7-12-17)21(24)23-18-13-8-9-14-19(18)26-4-2/h5-9,11-14,20,22H,3-4,10,15-16H2,1-2H3,(H,23,24)/p+1/t20-/m0/s1 |
| InChIKey | WSGDRZUDGGGPSS-FQEVSTJZSA-O |
| XLogP | 2.76 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|