C14H14N4O — CID 79288235
3-(2-methoxyphenyl)-7-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79288235) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-7-methylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(2-methoxyphenyl)-7-methylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79288235 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(2-methoxyphenyl)-7-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | COc1ccccc1-n1c(N)nc2c(C)ccnc21 |
| InChI | InChI=1S/C14H14N4O/c1-9-7-8-16-13-12(9)17-14(15)18(13)10-5-3-4-6-11(10)19-2/h3-8H,1-2H3,(H2,15,17) |
| InChIKey | SXCCTLSPRBBTGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |