C13H10Cl2N4 — CID 79288307
3-(3,5-dichlorophenyl)-7-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79288307) has the molecular formula C13H10Cl2N4 and a molecular weight of 293.16 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-7-methylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(3,5-dichlorophenyl)-7-methylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79288307 |
| Molecular Formula | C13H10Cl2N4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-7-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccnc2c1nc(N)n2-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N4/c1-7-2-3-17-12-11(7)18-13(16)19(12)10-5-8(14)4-9(15)6-10/h2-6H,1H3,(H2,16,18) |
| InChIKey | MHQGFATWUSWKEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |