C13H9F3N4 — CID 79294067
7-methyl-3-(2,4,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 79294067) has the molecular formula C13H9F3N4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 7-methyl-3-(2,4,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 7-methyl-3-(2,4,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79294067 |
| Molecular Formula | C13H9F3N4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-methyl-3-(2,4,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccnc2c1nc(N)n2-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H9F3N4/c1-6-2-3-18-12-11(6)19-13(17)20(12)10-5-8(15)7(14)4-9(10)16/h2-5H,1H3,(H2,17,19) |
| InChIKey | HYTCPZQULTUVTF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|