C15H13BrClN3 — CID 79294010
3-(4-bromo-2-methylphenyl)-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine (PubChem CID 79294010) has the molecular formula C15H13BrClN3 and a molecular weight of 350.65 g/mol. Its IUPAC name is 3-(4-bromo-2-methylphenyl)-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine.
| Compound Name | 3-(4-bromo-2-methylphenyl)-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79294010 |
| Molecular Formula | C15H13BrClN3 |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 3-(4-bromo-2-methylphenyl)-2-(chloromethyl)-7-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1cc(Br)ccc1-n1c(CCl)nc2c(C)ccnc21 |
| InChI | InChI=1S/C15H13BrClN3/c1-9-5-6-18-15-14(9)19-13(8-17)20(15)12-4-3-11(16)7-10(12)2/h3-7H,8H2,1-2H3 |
| InChIKey | SGWJEOPETDRIFX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|