C17H18ClN3 — CID 79276029
2-(2-chloroethyl)-3-(2,4-dimethylphenyl)-7-methylimidazo[4,5-b]pyridine (PubChem CID 79276029) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-(2,4-dimethylphenyl)-7-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3-(2,4-dimethylphenyl)-7-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79276029 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(2-chloroethyl)-3-(2,4-dimethylphenyl)-7-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(-n2c(CCCl)nc3c(C)ccnc32)c(C)c1 |
| InChI | InChI=1S/C17H18ClN3/c1-11-4-5-14(13(3)10-11)21-15(6-8-18)20-16-12(2)7-9-19-17(16)21/h4-5,7,9-10H,6,8H2,1-3H3 |
| InChIKey | STQKPCRTFYARNF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|