C15H13ClIN3 — CID 79294083
2-(2-chloroethyl)-3-(3-iodophenyl)-7-methylimidazo[4,5-b]pyridine (PubChem CID 79294083) has the molecular formula C15H13ClIN3 and a molecular weight of 397.65 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-(3-iodophenyl)-7-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3-(3-iodophenyl)-7-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79294083 |
| Molecular Formula | C15H13ClIN3 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2-(2-chloroethyl)-3-(3-iodophenyl)-7-methylimidazo[4,5-b]pyridine |
| SMILES | Cc1ccnc2c1nc(CCCl)n2-c1cccc(I)c1 |
| InChI | InChI=1S/C15H13ClIN3/c1-10-6-8-18-15-14(10)19-13(5-7-16)20(15)12-4-2-3-11(17)9-12/h2-4,6,8-9H,5,7H2,1H3 |
| InChIKey | SFQHQCJYEAGFFO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|